Identifikatoren & physikalische Daten
| CAS No. | 399004-05-8 |
|---|
| Summenformel | C18H17N3O3 |
|---|
| Durchschnittliche Molmasse | 323,3 g/mol |
|---|
| Monoisotopische Masse | 323,12699141 g/mol |
|---|
| SMILES | Cc1cc(C)cc(NC(=O)COC(=O)c2n[nH]c3ccccc23)c1 |
|---|
| InChIKey | ZSWRDGHJOFVNTO-UHFFFAOYSA-N |
|---|
| PubChem CID | 2098549 |
|---|
| ChEMBL | CHEMBL1319262 |
|---|
| DTXSID | DTXSID601321752 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|
| Polarare Oberfläche (TPSA) | 84,1 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 24 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 460 |
|---|
| Löslichkeit | 2.4 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-(3,5-dimethylanilino)-2-oxoethyl] 1H-indazole-3-carboxylate](/img/chemical/2098549.png)