HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2099331Erstellt: 3. November 2026
[2-[4-(Difluoromethoxy)phenyl]-2-oxoethyl] 2-chloropyridine-3-carboxylate
https://huagongshe.com/de/chemical/2099331
Identifikatoren & physikalische Daten
| CAS No. | 473405-32-2 |
|---|
| Summenformel | C15H10ClF2NO4 |
|---|
| Durchschnittliche Molmasse | 341,69 g/mol |
|---|
| Monoisotopische Masse | 341,0266418 g/mol |
|---|
| SMILES | O=C(COC(=O)c1cccnc1Cl)c1ccc(OC(F)F)cc1 |
|---|
| InChIKey | MXQRUEWUJSNFCX-UHFFFAOYSA-N |
|---|
| PubChem CID | 2099331 |
|---|
| ChEMBL | CHEMBL1604445 |
|---|
| DTXSID | DTXSID801324657 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4 |
|---|
| Polarare Oberfläche (TPSA) | 65,5 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 416 |
|---|
| Löslichkeit | 51.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-[4-(Difluoromethoxy)phenyl]-2-oxoethyl] 2-chloropyridine-3-carboxylate](/img/chemical/2099331.png)