HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2115477Erstellt: 2. November 2026
Methyl 4-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamido]benzoate
https://huagongshe.com/de/chemical/2115477
Identifikatoren & physikalische Daten
| CAS No. | 749880-53-3 |
|---|
| Summenformel | C19H23N3O5 |
|---|
| Durchschnittliche Molmasse | 373,4 g/mol |
|---|
| Monoisotopische Masse | 373,16377084 g/mol |
|---|
| SMILES | COC(=O)c1ccc(NC(=O)CN2C(=O)NC3(CCC(C)CC3)C2=O)cc1 |
|---|
| InChIKey | NXYZCKOEBXSTSB-UHFFFAOYSA-N |
|---|
| PubChem CID | 2115477 |
|---|
| ChEMBL | CHEMBL2132304 |
|---|
| DTXSID | DTXSID901331364 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|
| Polarare Oberfläche (TPSA) | 105 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 27 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 619 |
|---|
| Löslichkeit | 10.1 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von Methyl 4-[2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamido]benzoate](/img/chemical/2115477.png)