HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Alprazolam
Xanax · Zolam · 8-CHLORO-1-METHYL-6-PHENYL-4H-[1,2,4]TRIAZOLO[4,3-A][1,4]BENZODIAZEPINE · Trankimazin · 8-Chloro-1-methyl-6-phenyl-4H-2,3,5,10b-tetraazabenzo[e]azulene · d65mt · Tafil · TUS-1
Identifikatoren & physikalische Daten
| CAS No. | 28981-97-7 |
|---|---|
| Summenformel | C17H13ClN4 |
| Durchschnittliche Molmasse | 308,8 g/mol |
| Monoisotopische Masse | 308,0828741 g/mol |
| SMILES | Cc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1)=NC2 |
| InChIKey | VREFGVBLTWBCJP-UHFFFAOYSA-N |
| PubChem CID | 2118 |
| ChEMBL | CHEMBL661 |
| ChEBI | CHEBI:2611 |
| EC No. | 249-349-2 |
| DTXSID | DTXSID4022577 |
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 43,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 434 |
| Schmelzpunkt | 228-228.50C |
| Siedepunkt | 463.51°C (rough estimate) |
| Dichte | 1.2000 (rough estimate) |
| Brechungsindex | 1.6110 (estimate) |
| Flammpunkt | 11 °C |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | H2O: insoluble70mg/L(ambient temperature) |
| pKa (Säurekonstante) | 2.37±0.40(Predicted) |
| BCS Class | 1 |
| Hauptanwendungen | pharmaceutical (small molecule) |
| InChI | 1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3 |
| InChIKey | VREFGVBLTWBCJP-UHFFFAOYSA-N |
| SMILES | Cc1nnc2CN=C(c3ccccc3)c4cc(Cl)ccc4-n12 |
| CAS Datenbank | 28981-97-7(CAS DataBase Reference) |
| NIST chemische Informationen | Alprazolam(28981-97-7) |
| EPA chemische Informationen | Alprazolam (28981-97-7) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | 3249 |
| Zollcode | 2933910000 |
| RTECS-Nr. | XZ5473000 |
| R-Sätze (R) | 22-39/23/24/25-23/24/25-11 |
| Toxizität | LD50 in mice, rats (mg/kg): 1020, >2000 orally540, 610 i.p. (Nakajima) |
| Gefahrensymbole | Xn,T,F |
| Sicherheitshinweise (S) | 36-45-36/37-16-7 |
| Gefahrenklasse | 6.1(b)Acute Tox. 4 Oral |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 28981-97-7(Hazardous Substances Data) |
| DEA Controlled Substances | CSCN: 2882CAS SCH: ⅣNARC: N |
Anwendungen & Verwendung
Beschreibung
Alprazolam (Item No. 14255) is an analytical reference material categorized as a benzodiazepine. Alprazolam is regulated as a Schedule IV compound in the United States. This product is intended for research and forensic applications.
Verwenden
Controlled substance (depressant). Anxiolytic