Identifikatoren & physikalische Daten
| CAS No. | 743445-70-7 |
|---|
| Summenformel | C20H21NO4 |
|---|
| Durchschnittliche Molmasse | 339,4 g/mol |
|---|
| Monoisotopische Masse | 339,14705815 g/mol |
|---|
| SMILES | CC(C)(C)NC(=O)COC(=O)C1c2ccccc2Oc2ccccc21 |
|---|
| InChIKey | YGBUNAZFHRTNFJ-UHFFFAOYSA-N |
|---|
| PubChem CID | 2118973 |
|---|
| ChEMBL | CHEMBL1362409 |
|---|
| DTXSID | DTXSID001320887 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|
| Polarare Oberfläche (TPSA) | 64,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 25 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 476 |
|---|
| Löslichkeit | 48.9 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-(tert-butylamino)-2-oxoethyl] 9H-xanthene-9-carboxylate](/img/chemical/2118973.png)