HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-[(2-chlorophenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide
N-(2-chlorobenzyl)-2-hydroxyquinoline-4-carboxamide · 4-Quinolinecarboxamide, N-[(2-chlorophenyl)methyl]-1,2-dihydro-2-oxo-
![Molekülstruktur von N-[(2-chlorophenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide](/img/chemical/2124752.png)
Identifikatoren & physikalische Daten
| CAS No. | 752228-61-8 |
|---|---|
| Summenformel | C17H13ClN2O2 |
| Durchschnittliche Molmasse | 312,7 g/mol |
| Monoisotopische Masse | 312,0665554 g/mol |
| SMILES | O=C(NCc1ccccc1Cl)c1cc(=O)[nH]c2ccccc12 |
| InChIKey | WADYODWZFZVIDU-UHFFFAOYSA-N |
| PubChem CID | 2124752 |
| ChEMBL | CHEMBL1430392 |
| DTXSID | DTXSID101324549 |
Chemische & physikalische Eigenschaften
| XLogP | 2,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 58,2 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 477 |
| Löslichkeit | 7.4 [ug/mL] (The mean of the results at pH 7.4) |
| Siedepunkt | 618.5±55.0 °C(Predicted) |
| Dichte | 1.343±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 10.92±0.70(Predicted) |