Amantadin
1-ADAMANTYLAMINE · Adamantylamine · 1-ADAMANTANAMINE · adamantan-1-amine · (3s,5s,7s)-adaMantan-1-aMine · Adamantamine · ADAMANTANAMINE · 1-AMINOADAMANTANE
Identifikatoren & physikalische Daten
| CAS No. | 768-94-5 |
|---|---|
| Summenformel | C10H17N |
| Durchschnittliche Molmasse | 151,25 g/mol |
| Monoisotopische Masse | 151,13609955 g/mol |
| SMILES | NC12CC3CC(CC(C3)C1)C2 |
| InChIKey | DKNWSYNQZKUICI-UHFFFAOYSA-N |
| PubChem CID | 2130 |
| ChEMBL | CHEMBL660 |
| ChEBI | CHEBI:2618 |
| EC No. | 212-201-2 |
| DTXSID | DTXSID8022117 |
| Lokaler Name | Amantadin |
Chemische & physikalische Eigenschaften
| XLogP | 2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 26 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 144 |
| Schmelzpunkt | 206-208 °C(lit.) |
| Siedepunkt | 263.29°C (rough estimate) |
| Dichte | 0.9510 (rough estimate) |
| Brechungsindex | 1.5220 (estimate) |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Löslichkeit | 1 M HCl: soluble5%, clear to hazy, colorless to faint yellow or tanSoluble in organic solvents. Insoluble in water. |
| Aggregatzustand | Powder |
| pKa (Säurekonstante) | 10.1(at 25℃) |
| Farbe | White to cream |
| Merck | 14,374 |
| BRN | 2204333 |
| Hauptanwendungen | food and beveragespersonal carepharmaceutical |
| InChI | 1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2/t7-,8+,9-,10- |
| InChIKey | DKNWSYNQZKUICI-UHFFFAOYSA-N |
| SMILES | NC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| CAS Datenbank | 768-94-5(CAS DataBase Reference) |
| NIST chemische Informationen | Tricyclo[3.3.1.13,7]decane-1-amine(768-94-5) |
| EPA chemische Informationen | Tricyclo[3.3.1.13,7]decan-1-amine (768-94-5) |
Sicherheit & Vorschriften
| F | 10-34 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29213000 |
| RTECS-Nr. | YD1925000 |
| R-Sätze (R) | 22-36/37/38 |
| Toxizität | LD50 oral in rat: 900mg/kg |
| Gefahrensymbole | Xn,Xi |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrstoffdaten | 768-94-5(Hazardous Substances Data) |
| Gefahrenklasse | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Beschreibung
Amantadine is an agent that raises the concentration of dopamine in the synaptic cleft by releasing it from neurons and suppressing the process of reuptake.
Verwenden
Amantadine is a primary amine derivative of adamantane. It has an effect on mycoviruses, which are RNA-containing viruses. It has a very narrow spectrum of action and is used only for treating and preventing influenza A. It is also used for treating Parkinsonism. The exact mechanism of antiviral action of amantadine is not completely understood. It is believed that it is an ion channel blocker. It has also been suggested that amantadine inhibits absorption of viral particles into the host cell, which is expressed in the breakdown of diffusion of the virus into the cell, or inhibition of the “stripping process” of the virus. The main use is for the prevention of type A2 influenza. Synonyms of this drug are simmetrel, viregit, mantadan, and others.