HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-((6-Chloro-3-pyridinyl)methyl)-N'-cyano-N-methylethanimidamide
Assail · MORTAL · MOSPILAN · MOSPILDATE · acetamipri · ACETAMIPRIISS · ACETAMIPRID 95%TC · (E/Z)-Acetamiprid
Identifikatoren & physikalische Daten
| CAS No. | 135410-20-7 |
|---|---|
| Summenformel | C10H11ClN4 |
| Durchschnittliche Molmasse | 222,67 g/mol |
| Monoisotopische Masse | 222,06722403 g/mol |
| SMILES | CC(=NC#N)N(C)Cc1ccc(Cl)nc1 |
| InChIKey | WCXDHFDTOYPNIE-UHFFFAOYSA-N |
| PubChem CID | 213021 |
| ChEMBL | CHEMBL3185634 |
| ChEBI | CHEBI:39163 |
| EC No. | 682-791-8 |
| DTXSID | DTXSID901015148 |
Chemische & physikalische Eigenschaften
| XLogP | 1,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 52,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 280 |
| Pestizide | PesticidesInsecticidesEnvironmental transformation -> Pesticides (parent, predecessor) |
| LogP (Verteilungskoeffizient) | 0.8 |
| Collision Cross Section | 155.1 Ų [M+H]+ [CCS Type: DTBuffer gas: N2Ionization: APCI+Dataset: TOXCASTSource Identifier: DTXSID0034300]150.24 Ų [M+H]+ [CCS Type: TW]157.86 Ų [M+Na]+ |
| Schmelzpunkt | 100-102°C |
| Siedepunkt | 352.380±52.00 °C(Press: 760.00 Torr)(predicted) |
| Dichte | 1.174±0.14 g/cm3(Temp: 25 °CPress: 760 Torr)(predicted) |
| Lagerbedingungen | 2-8°C |
| pKa (Säurekonstante) | -0.440±0.10(predicted) |
| Hauptanwendungen | agricultureenvironmental |
| InChI | InChI=1S/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3/b14-8+ |
| InChIKey | WCXDHFDTOYPNIE-RIYZIHGNSA-N |
| SMILES | C(/N(CC1=CC=C(Cl)N=C1)C)(=N\C#N)\C |
| LogP (Verteilungskoeffizient) | 0.620 (est) |
| CAS Datenbank | 160430-64-8(CAS DataBase Reference) |
| NIST chemische Informationen | Acetamiprid(160430-64-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301: Toxic if swallowed [Danger Acute toxicity, oral]P203, P264, P270, P273, P280, P301+P316, P318, P321, P330, P391, P405, and P501 (click each P-code to see the statement)H301 (97.4%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P264, P270, P271, P273, P284, P301+P316, P304+P340, P316, P320, P321, P330, P403+P233, P405, and P501 (click each P-code to see the statement) |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (97.4%)Acute toxicity (Oral) - Category 3Repr. 2 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2811 |
| RTECS-Nr. | KJ4235200 |
| R-Sätze (R) | 23/25-57 |
| Toxizität | LD50 in male, female rats, male, female mice (mg/kg): 217, 146, 198, 184 orally (Takahashi) |
| Gefahrensymbole | T |
| Sicherheitshinweise (S) | 45 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Gefahrenklasse | Acute Tox. 3 OralAquatic Acute 1Aquatic Chronic 1Repr. 2 |
Anwendungen & Verwendung
Verwenden
Insecticide.