Amfonelic Acid
NCA · Amfonelic · 7-Benzyl-1-ethyl-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid · CEAL · WIN-25978 · NSC-100638 · Amphonic acid · AMFONELIC ACID
Identifikatoren & physikalische Daten
| CAS No. | 15180-02-6 |
|---|---|
| Summenformel | C18H16N2O3 |
| Durchschnittliche Molmasse | 308,3 g/mol |
| Monoisotopische Masse | 308,11609238 g/mol |
| SMILES | CCn1cc(C(=O)O)c(=O)c2ccc(Cc3ccccc3)nc21 |
| InChIKey | WHHHJDGNBVQNAU-UHFFFAOYSA-N |
| PubChem CID | 2137 |
| ChEMBL | CHEMBL35337 |
| EC No. | 878-363-7 |
| DTXSID | DTXSID40164877 |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 70,5 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 23 |
| Formalladung | 0 |
| Komplexität | 496 |
| Schmelzpunkt | >1000 °C |
| Siedepunkt | 499℃ |
| Dichte | 1.297 |
| Flammpunkt | 256℃ |
| Löslichkeit | 0.1 M NaOH: soluble |
| Aggregatzustand | powder |
| pKa (Säurekonstante) | 3.50±0.20(Predicted) |
| Farbe | yellow |
| InChI | InChI=1S/C18H16N2O3/c1-2-20-11-15(18(22)23)16(21)14-9-8-13(19-17(14)20)10-12-6-4-3-5-7-12/h3-9,11H,2,10H2,1H3,(H,22,23) |
| InChIKey | WHHHJDGNBVQNAU-UHFFFAOYSA-N |
| SMILES | N1(CC)C2C(=CC=C(CC3=CC=CC=C3)N=2)C(=O)C(C(O)=O)=C1 |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P264, P264+P265, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, and P362+P364 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 2933.99.8290 |
| R-Sätze (R) | 40-43 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36/37 |
Anwendungen & Verwendung
Beschreibung
Amfonelic acid, a derivative of nalidixic acid, was originally developed as a central nervous system stimulant. It is a highly potent nonamphetamine stimulant whose actions are inhibited by reserpine but not by the tyrosine hydroxylase inhibitor, a-methyltyrosine. Additionally, it enhances the impacts of antipsychotic medicines such as haloperidol, trifluoperazine, and spiperone.
Verwenden
Amfonelic acid (AFA) is a dopamine reuptake inhibitor, that has marked effects on brain dopamine metabolism but not noradrenaline metabolism. Experiments on rats have shown that AFA treatment completely prevented the effects of methamphetamine on the dopaminergic system, both morphologically and biochemically. Rats are shown to self-administer amfonelic acid in a dose-dependent manner.