Identifikatoren & physikalische Daten
| CAS No. | 620931-50-2 |
|---|
| Summenformel | C18H17NO3 |
|---|
| Durchschnittliche Molmasse | 295,3 g/mol |
|---|
| Monoisotopische Masse | 295,1208434 g/mol |
|---|
| SMILES | Cc1ccc(OCCN2C(=O)C(=O)c3cc(C)ccc32)cc1 |
|---|
| InChIKey | YLRIIEKOEYGRFS-UHFFFAOYSA-N |
|---|
| PubChem CID | 2145489 |
|---|
| ChEMBL | CHEMBL1388853 |
|---|
| DTXSID | DTXSID601322348 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|
| Polarare Oberfläche (TPSA) | 46,6 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 428 |
|---|
| Löslichkeit | 4.1 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 5-Methyl-1-[2-(4-methylphenoxy)ethyl]indole-2,3-dione](/img/chemical/2145489.png)