HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,3-Diphenylisobenzofuran
DIB · DPBF · Diphenylisobenzofuran · SKL177 · 1,3-DPBF · Diphenylbenzofuran · 1,3-DIPHENYLISOBENZOFURAN · 1,3-DIPHENYL-2-BENZOFURAN
Identifikatoren & physikalische Daten
| CAS No. | 5471-63-6 |
|---|---|
| Summenformel | C20H14O |
| Durchschnittliche Molmasse | 270,3 g/mol |
| Monoisotopische Masse | 270,10446507 g/mol |
| SMILES | c1ccc(-c2oc(-c3ccccc3)c3ccccc23)cc1 |
| InChIKey | ZKSVYBRJSMBDMV-UHFFFAOYSA-N |
| PubChem CID | 21649 |
| EC No. | 226-808-5 |
| DTXSID | DTXSID40203179 |
| Lokaler Name | 1,3-Diphenylisobenzofuran |
Chemische & physikalische Eigenschaften
| XLogP | 5,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 13,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 295 |
| Schmelzpunkt | 128-130 °C (lit.) |
| Siedepunkt | 373.44°C (rough estimate) |
| Dichte | 1.0717 (rough estimate) |
| Brechungsindex | 1.6700 (estimate) |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,2-8°C |
| Aggregatzustand | Crystalline Solid or Needles |
| Farbe | Yellow to green |
| Löslichkeit | Soluble in toluene. Insoluble in water. |
| BRN | 199922 |
| InChI | InChI=1S/C20H14O/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20(21-19)16-11-5-2-6-12-16/h1-14H |
| InChIKey | ZKSVYBRJSMBDMV-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=C2C(C=CC=C2)=C(C2=CC=CC=C2)O1 |
| CAS Datenbank | 5471-63-6(CAS DataBase Reference) |
| NIST chemische Informationen | 1,3 Diphenylisobenzofuran(5471-63-6) |
Sicherheit & Vorschriften
| Regulatorische Informationen | Isobenzofuran, 1,3-diphenyl-: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| F | 8 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29329990 |
| R-Sätze (R) | 22-24/25 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
1,3-Diphenylisobenzofuran(DPBF) was used as a fluorescent probe for detection of superoxide anion radical (O2) inside the membrane lipid layer by DPBF fluorescence quenching method. 1,3-Diphenylisobenzofuran(DPBF) was used as quencher during the photoinactivation of TA-3 mouse mammary carcinoma cells containing hematoporphyrin. 1,3-Diphenylisobenzofuran(DPBF) was used to study the single crystal molecular structure and solution photophysical properties of DPBF.