HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-(3-(Trifluoromethyl)phenyl)-1-piperazineethanol
4-[3-(Trifluoromethyl)phenyl]-1-piperazineethanol · 1-Piperazineethanol, 4-[3-(trifluoromethyl)phenyl]- · 2-(4-(3-(trifluoromethyl)phenyl)piperazin-1-yl)ethanol · N-2-hydroxyethyl-N'-(3-trifluoromethylphenyl)-piperazine
Identifikatoren & physikalische Daten
| CAS No. | 40004-29-3 |
|---|---|
| Summenformel | C13H17F3N2O |
| Durchschnittliche Molmasse | 274,28 g/mol |
| Monoisotopische Masse | 274,12929766 g/mol |
| SMILES | OCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChIKey | FTMNSXDJPJHNSF-UHFFFAOYSA-N |
| PubChem CID | 217994 |
| DTXSID | DTXSID90193071 |
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 19 |
| Formalladung | 0 |
| Komplexität | 278 |
| Siedepunkt | 369.9±42.0 °C(Predicted) |
| Dichte | 1.239±0.06 g/cm3(Predicted) |
| Löslichkeit | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 14.96±0.10(Predicted) |
| Aggregatzustand | Low-Melting Solid |
| Farbe | White to Off-White |
Anwendungen & Verwendung
Verwenden
2-[4-(3-Trifluoromethylphenyl)-1-piperazinyl]propanol is an intermediate in the synthesis of Antrafenine (A697800), a phenylpiperazine derivative drug used as an analgesic and anti-inflammatory.