HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N,N-Dimethylpyridin-2-amin
N,N-dimethylpyridin-2-amine · 2-(N,N-dimethylamino)pyridine · 2-Dimethylaminopyridin · 2-DIMETHYLAMINOPYRIDINE · 2-dimethylamino-pyridin · dimethylamino-2pyridine · (2-Pyridinyl)dimethylamine · (Dimethylamino)-2-pyridine
Identifikatoren & physikalische Daten
| CAS No. | 5683-33-0 |
|---|---|
| Summenformel | C7H10N2 |
| Durchschnittliche Molmasse | 122,17 g/mol |
| Monoisotopische Masse | 122,08439832 g/mol |
| SMILES | CN(C)c1ccccn1 |
| InChIKey | PSHKMPUSSFXUIA-UHFFFAOYSA-N |
| PubChem CID | 21885 |
| EC No. | 227-147-5 |
| DTXSID | DTXSID9022231 |
| Lokaler Name | N,N-Dimethylpyridin-2-amin |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 16,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 81 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| Schmelzpunkt | 182°C |
| Siedepunkt | 191 °C(lit.) |
| Dichte | 0.984 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.559(lit.) |
| Flammpunkt | 167 °F |
| Lagerbedingungen | Store below +30°C. |
| pKa (Säurekonstante) | 7.04±0.10(Predicted) |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless to pale yellow |
| Löslichkeit | Soluble in water. |
| BRN | 110353 |
| InChI | InChI=1S/C7H10N2/c1-9(2)7-5-3-4-6-8-7/h3-6H,1-2H3 |
| InChIKey | PSHKMPUSSFXUIA-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=NC=CC=C1 |
| CAS Datenbank | 5683-33-0(CAS DataBase Reference) |
| NIST chemische Informationen | N,N-Dimethyl-2-pyridinamine(5683-33-0) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (10.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | 2-(Dimethylamino)pyridine: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (10.9%) |
| F | 10 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 1993 |
| Zollcode | 29333999 |
| RTECS-Nr. | US9200000 |
| R-Sätze (R) | 36/37/38-34-23/24/25 |
| Gefahrensymbole | Xi,T |
| Sicherheitshinweise (S) | 23-26-36-45-36/37/39-27 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
2-(Dimethylamino)pyridine in toluene at room temperature in the presence of 1.1 equivalent of methyl trifluoromethanesulfonate forms (2-pyridyl)-trimethylammonium trifluoromethanesulfonate salt. It is used as a model substrate in the preparation of chelate carbene via cyclometalation, H2 loss and reversible α-elimination.