Androsta-1,4-dien-3,17-dion
Boldione · 1,4-ANDROSTADIENEDIONE · ANDROSTADIENEDIONE · 1,4-ANDROSTADIENE-3,17-DIONE · 10,13-DIMETHYL-7,8,9,11,12,14,15,16-OCTAHYDRO-6H-CYCLOPENTA[A]PHENANTHRENE-3,17-DIONE · 10,13-DIMETHYL-7,8,9,10,11,12,13,14,15,16-DECAHYDRO-3H-CYCLOPENTA[A]PHENANTHRENE-3,17(6H)-DIONE · (8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione · (8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,10,11,12,13,14,15,16-decahydro-3H-cyclopenta[a]phenanthrene-3,17(6H)-dione
Identifikatoren & physikalische Daten
| CAS No. | 897-06-3 |
|---|---|
| Summenformel | C19H24O2 |
| Durchschnittliche Molmasse | 284,4 g/mol |
| SMILES | CC12C=CC(=O)C=C1CCC1C2CCC2(C)C(=O)CCC12 |
| InChIKey | LUJVUUWNAPIQQI-UHFFFAOYSA-N |
| PubChem CID | 2192 |
| ChEMBL | CHEMBL8512 |
| ChEBI | CHEBI:182567 |
| Lokaler Name | Androsta-1,4-dien-3,17-dion |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 34,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 584 |
| Schmelzpunkt | 138-139 °C(lit.) |
| Siedepunkt | 434.2±45.0 °C(Predicted) |
| Dichte | 1.14±0.1 g/cm3(Predicted) |
| Dampfdruck | 0Pa at 20℃ |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | DMF: 50 mg/mlDMF:PBS(pH 7.2)(1:1): 0.5 mg/mlDMSO: 30 mg/mlEthanol: 5 mg/ml430mg/L at 20℃ |
| Aggregatzustand | A crystalline solid |
| Hauptanwendungen | pharmaceutical |
| InChI | 1S/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-16H,3-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | LUJVUUWNAPIQQI-QAGGRKNESA-N |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]4(C)C(=O)CC[C@@]24[H] |
| LogP (Verteilungskoeffizient) | 2.2 at 25℃ |
| CAS Datenbank | 897-06-3(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29372900 |
| RTECS-Nr. | BV7988000 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Gefahrenklasse | Aquatic Chronic 2Carc. 2Lact.Repr. 1B |
| DEA Controlled Substances | CSCN: 4000CAS SCH: ⅢNARC: N |
Anwendungen & Verwendung
Beschreibung
Androsta-1,4-diene-3,17-dione (Item No. 24081) is an analytical reference standard categorized as an anabolic androgenic steroid. Androsta-1,4-diene-3,17-dione is a precursor in the synthesis of boldenone and has been used to enhance athletic performance. Androsta-1,4-diene-3,17-dione is regulated as a Schedule III compound in the United States. This product is intended for research and forensic applications.
Verwenden
Boldenone related steroid; anabolic androgenic steroid