Identifikatoren & physikalische Daten
| CAS No. | 186517-26-0 |
|---|
| Summenformel | C8H4F5NO |
|---|
| Durchschnittliche Molmasse | 225,11 g/mol |
|---|
| Monoisotopische Masse | 225,02130485 g/mol |
|---|
| SMILES | NC(=O)c1c(C(F)(F)F)ccc(F)c1F |
|---|
| InChIKey | GGCPJJFCTISPMQ-UHFFFAOYSA-N |
|---|
| PubChem CID | 22010119 |
|---|
| EC No. | 852-006-5 |
|---|
| DTXSID | DTXSID901028355 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|
| Polarare Oberfläche (TPSA) | 43,1 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 254 |
|---|
| Pestizide | Environmental transformation -> Pesticide transformation products (metabolite, successor) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH227 (100%): Combustible liquid [Warning Flammable liquids]P210, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Flam. Liq. 4 (100%) |
|---|
