HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 220145Erstellt: 3. November 2026
O-(N-(4-Chlorophenyl)carbamoyl)acetone oxime
O-(N-(4-Chlorophenyl)carbamoyl)acetone oxime · 2-Propanone, O-[[(4-chlorophenyl)amino]carbonyl]oxime (9CI)
https://huagongshe.com/de/chemical/220145
Identifikatoren & physikalische Daten
| CAS No. | 2911-48-0 |
|---|
| Summenformel | C10H11ClN2O2 |
|---|
| Durchschnittliche Molmasse | 226,66 g/mol |
|---|
| Monoisotopische Masse | 226,0509053 g/mol |
|---|
| SMILES | CC(C)=NOC(=O)Nc1ccc(Cl)cc1 |
|---|
| InChIKey | BPIZNAFVAYSYMY-UHFFFAOYSA-N |
|---|
| PubChem CID | 220145 |
|---|
| EC No. | 666-825-9 |
|---|
| DTXSID | DTXSID40277471 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|
| Polarare Oberfläche (TPSA) | 50,7 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 15 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 244 |
|---|
| Schmelzpunkt | 117.5 °C |
|---|
| Dichte | 1.21±0.1 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 12.21±0.70(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
