Identifikatoren & physikalische Daten
| CAS No. | 847652-81-7 |
|---|
| Summenformel | C7H6Cl2O3S |
|---|
| Durchschnittliche Molmasse | 241,09 g/mol |
|---|
| Monoisotopische Masse | 239,9414706 g/mol |
|---|
| SMILES | COc1c(Cl)cccc1S(=O)(=O)Cl |
|---|
| InChIKey | UFESGJFEJHJCON-UHFFFAOYSA-N |
|---|
| PubChem CID | 22015367 |
|---|
| EC No. | 857-032-0 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,5 |
|---|
| Polarare Oberfläche (TPSA) | 51,8 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 13 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 259 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P264, P270, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P330, P363, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
