Identifikatoren & physikalische Daten
| CAS No. | 205055-20-5 |
|---|
| Summenformel | C7H3Cl2NO2S2 |
|---|
| Durchschnittliche Molmasse | 268,1 g/mol |
|---|
| SMILES | O=S(=O)(Cl)c1cc2nc(Cl)ccc2s1 |
|---|
| InChIKey | DDOAASFFFGZAFG-UHFFFAOYSA-N |
|---|
| PubChem CID | 22017299 |
|---|
| EC No. | 858-707-2 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|
| Polarare Oberfläche (TPSA) | 83,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 316 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P264, P270, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P330, P363, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
![Molekülstruktur von 5-Chlorothieno[3,2-b]pyridine-2-sulfonyl chloride](/img/chemical/22017299.png)