HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 22108Erstellt: 27. Oktober 2026
2,5-Dichlor-4-nitrophenol
4-Nitro-2,5-dichlorophenol · Phenol, 2,5-dichloro-4-nitro-
https://huagongshe.com/de/chemical/22108
Identifikatoren & physikalische Daten
| CAS No. | 5847-57-4 |
|---|
| Summenformel | C6H3Cl2NO3 |
|---|
| Durchschnittliche Molmasse | 208 g/mol |
|---|
| Monoisotopische Masse | 206,94899832 g/mol |
|---|
| SMILES | O=[N+]([O-])c1cc(Cl)c(O)cc1Cl |
|---|
| InChIKey | BWQWBOCFVUBGEF-UHFFFAOYSA-N |
|---|
| PubChem CID | 22108 |
|---|
| EC No. | 227-439-2 |
|---|
| DTXSID | DTXSID50207163 |
|---|
| Lokaler Name | 2,5-Dichlor-4-nitrophenol |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,5 |
|---|
| Polarare Oberfläche (TPSA) | 66,1 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 12 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 184 |
|---|
| Schmelzpunkt | 117 °C(Solv: carbon tetrachloride (56-23-5)) |
|---|
| Siedepunkt | 317.0±42.0 °C(Predicted) |
|---|
| Dichte | 1.682±0.06 g/cm3(Predicted) |
|---|
| Lagerbedingungen | 2-8°C |
|---|
| Löslichkeit | DMSO (Slightly), Methanol (Slightly) |
|---|
| Aggregatzustand | Solid |
|---|
| pKa (Säurekonstante) | 4+-.0.24(Predicted) |
|---|
| Farbe | Pale Yellow to Light Yellow |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Achtung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
