HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-Methyl-4-anisidin
4-METHOXY-N-METHYLANILINE · N-Methyl-p-ansidine · N-METHYL-4-ANISIDINE · N-Methyl-p-anisidine · p-Anisidine, N-methyl- · N-METHYL-PARA-ANISIDINE · N-Methyl-p-anisidine>N-Methyl-p-anisidine,98% · p-Methoxy-N-methylaniline
Identifikatoren & physikalische Daten
| CAS No. | 5961-59-1 |
|---|---|
| Summenformel | C8H11NO |
| Durchschnittliche Molmasse | 137,18 g/mol |
| Monoisotopische Masse | 137,08406397 g/mol |
| SMILES | CNc1ccc(OC)cc1 |
| InChIKey | JFXDIXYFXDOZIT-UHFFFAOYSA-N |
| PubChem CID | 22250 |
| EC No. | 227-735-1 |
| DTXSID | DTXSID80208289 |
| Lokaler Name | N-Methyl-4-anisidin |
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 21,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 87,3 |
| Schmelzpunkt | 33-36 °C(lit.) |
| Siedepunkt | 135-136 °C19 mm Hg(lit.) |
| Dichte | 1.0630 (rough estimate) |
| Brechungsindex | 1.5470 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Löslichkeit | soluble in Methanol |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 5.55±0.12(Predicted) |
| Farbe | Yellow |
| BRN | 774640 |
| InChI | InChI=1S/C8H11NO/c1-9-7-3-5-8(10-2)6-4-7/h3-6,9H,1-2H3 |
| InChIKey | JFXDIXYFXDOZIT-UHFFFAOYSA-N |
| SMILES | C1(NC)=CC=C(OC)C=C1 |
| CAS Datenbank | 5961-59-1(CAS DataBase Reference) |
| NIST chemische Informationen | Benzenamine, 4-methoxy-N-methyl-(5961-59-1) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| F | 10 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 2811 |
| Zollcode | 29222990 |
| R-Sätze (R) | 20/21/22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 22-24/25-36/37 |
| Gefahrenklasse | 6.1 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
N-METHYL-P-ANISIDINE was used to study the additive effects of amines.