HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-[2-(4-Fluorophenoxy)ethyl]isoindole-1,3-dione
![Molekülstruktur von 2-[2-(4-Fluorophenoxy)ethyl]isoindole-1,3-dione](/img/chemical/2230352.png)
Identifikatoren & physikalische Daten
| Summenformel | C16H12FNO3 |
|---|---|
| Durchschnittliche Molmasse | 285,27 g/mol |
| Monoisotopische Masse | 285,08012141 g/mol |
| SMILES | O=C1c2ccccc2C(=O)N1CCOc1ccc(F)cc1 |
| InChIKey | VVNAGOXDBCDUPI-UHFFFAOYSA-N |
| PubChem CID | 2230352 |
| ChEMBL | CHEMBL1306401 |
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 46,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 382 |
| Löslichkeit | 4 [ug/mL] (The mean of the results at pH 7.4) |