HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Amino-6-methyl-3-nitropyridine
2-AMINO-3-NITRO-6-PICOLINE · 6-AMINO-5-NITRO-2-PICOLINE · 6-AMINO-5-NITRO-2-PICOLINE,98% · 6-Methyl-3-nitro-2-pyridinamine · 6-Methyl-3-nitropyridine-2-amine · 2-AMINO-3-NITRO-6-METHYLPYRIDINE · 2-AMINO-6-METHYL-3-NITROPYRIDINE · 2-PyridinaMine, 6-Methyl-3-nitro-
Identifikatoren & physikalische Daten
| CAS No. | 21901-29-1 |
|---|---|
| Summenformel | C6H7N3O2 |
| Durchschnittliche Molmasse | 153,14 g/mol |
| Monoisotopische Masse | 153,05382646 g/mol |
| SMILES | Cc1ccc([N+](=O)[O-])c(N)n1 |
| InChIKey | LCJXSRQGDONHRK-UHFFFAOYSA-N |
| PubChem CID | 226028 |
| EC No. | 691-453-9 |
| DTXSID | DTXSID10280230 |
Chemische & physikalische Eigenschaften
| XLogP | 1,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 84,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 156 |
| Schmelzpunkt | 147-157 °C |
| Siedepunkt | 276.04°C (rough estimate) |
| Dichte | 1.3682 (rough estimate) |
| Brechungsindex | 1.6500 (estimate) |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Aggregatzustand | Crystalline Powder |
| pKa (Säurekonstante) | 2.50±0.50(Predicted) |
| Farbe | Yellow |
| Löslichkeit | Slightly soluble in water. |
| InChI | 1S/C6H7N3O2/c1-4-2-3-5(9(10)11)6(7)8-4/h2-3H,1H3,(H2,7,8) |
| InChIKey | LCJXSRQGDONHRK-UHFFFAOYSA-N |
| SMILES | CC1=NC(N)=C([N+]([O-])=O)C=C1 |
| CAS Datenbank | 21901-29-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (97.5%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P264, P264+P265, P270, P271, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P321, P330, P332+P317, P337+P317, P342+P316, P362+P364, P403, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.5%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29333990 |
| R-Sätze (R) | 36/37/38-20/21/22 |
| Gefahrensymbole | Xn,Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 36/37/39-26-22-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 OralEye Irrit. 2Resp. Sens. 1Skin Irrit. 2 |
Anwendungen & Verwendung
Verwenden
2-Amino-6-methyl-3-nitropyridine used as a intermediate in organic synthesis and used in medicine.