HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 227754Erstellt: 27. Oktober 2026
N-Phthaloyl-DL-phenylalanine
2H-Isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo-α-(phenylmethyl)-
https://huagongshe.com/de/chemical/227754
Identifikatoren & physikalische Daten
| CAS No. | 3588-64-5 |
|---|
| Summenformel | C17H13NO4 |
|---|
| Durchschnittliche Molmasse | 295,29 g/mol |
|---|
| Monoisotopische Masse | 295,0844579 g/mol |
|---|
| SMILES | O=C(O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
|---|
| InChIKey | VAYRSTHMTWUHGE-UHFFFAOYSA-N |
|---|
| PubChem CID | 227754 |
|---|
| ChEMBL | CHEMBL262870 |
|---|
| EC No. | 652-169-0 |
|---|
| DTXSID | DTXSID10281020 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,5 |
|---|
| Polarare Oberfläche (TPSA) | 74,7 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 445 |
|---|
| Schmelzpunkt | 182 °C |
|---|
| Siedepunkt | 498.0±38.0 °C(Predicted) |
|---|
| Dichte | 1.406±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 3.50±0.10(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P273, P301+P316, P321, P330, P391, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
