HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,4-Diamino-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid
2,4-Diamino-5,6,7,8-tetrahydroquinazoline-6-carboxylic acid · 2,4-DiaMino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid · 6-Quinazolinecarboxylic acid, 2,4-diamino-5,6,7,8-tetrahydro-
Identifikatoren & physikalische Daten
| CAS No. | 6974-25-0 |
|---|---|
| Summenformel | C9H12N4O2 |
| Durchschnittliche Molmasse | 208,22 g/mol |
| Monoisotopische Masse | 208,09602564 g/mol |
| SMILES | Nc1nc(N)c2c(n1)CCC(C(=O)O)C2 |
| InChIKey | GDKLVDMQUXYRHW-UHFFFAOYSA-N |
| PubChem CID | 229421 |
| DTXSID | DTXSID70281809 |
Chemische & physikalische Eigenschaften
| XLogP | -0,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 115 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 260 |
| Siedepunkt | 590.3±60.0 °C(Predicted) |
| Dichte | 1.492±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 3.74±0.20(Predicted) |
Anwendungen & Verwendung
Verwenden
2,4-Diamino-5,6,7,8-tetrahydro-6-quinazolinecarboxylic Acid, is a substituted 6-substituted 5,6,7,8-tetrahydroquinazolines, used for the synthesis of potential anticancer agents.