HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2,3,6-Trichloropyridine
2,3,6-TrichL · 2,5,6-Trichloropyridine · Pyridine,2,3,6-trichloro · 2,6-Dichloro-3-chloropyridine · 2,3,6-TRICHLOROPYRIDINE ISO 9001：2015 REACH
Identifikatoren & physikalische Daten
| CAS No. | 6515-09-9 |
|---|---|
| Summenformel | C5H2Cl3N |
| Durchschnittliche Molmasse | 182,43 g/mol |
| Monoisotopische Masse | 180,9252821 g/mol |
| SMILES | Clc1ccc(Cl)c(Cl)n1 |
| InChIKey | GPAKJVMKNDXBHH-UHFFFAOYSA-N |
| PubChem CID | 23016 |
| EC No. | 835-803-2 |
| DTXSID | DTXSID0073374 |
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 12,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 98,2 |
| LogP (Verteilungskoeffizient) | 2.77 |
| Schmelzpunkt | 66-67 °C |
| Siedepunkt | 300.44°C (rough estimate) |
| Dichte | 1.8041 (rough estimate) |
| Brechungsindex | 1.6300 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | soluble in Methanol |
| Aggregatzustand | powder to crystal |
| pKa (Säurekonstante) | -3.79±0.10(Predicted) |
| Farbe | Light yellow to Brown |
| InChI | InChI=1S/C5H2Cl3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| InChIKey | GPAKJVMKNDXBHH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1Cl |
| EPA chemische Informationen | 2,3,6-Trichloropyridine (6515-09-9) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (66.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (66.7%) |
| Zollcode | 2933399990 |
| Toxizität | LD50 ipr-mus: 150 mg/kg TXAPA9 11,361,67 |
Anwendungen & Verwendung
Verwenden
2,3,6-Trichloropyridine can be used as a catalyst for various compounds, such as, 2,3-dichloropyridine. This compound can also be used as an intermediate in chemosynthesis.