Identifikatoren & physikalische Daten
| CAS No. | 65609-38-3 |
|---|
| Summenformel | C15H13NO3 |
|---|
| Durchschnittliche Molmasse | 255,27 g/mol |
|---|
| Monoisotopische Masse | 255,08954328 g/mol |
|---|
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccccc1 |
|---|
| InChIKey | ZHSOGONPVBHPEW-UHFFFAOYSA-N |
|---|
| PubChem CID | 2306549 |
|---|
| ChEMBL | CHEMBL1313259 |
|---|
| DTXSID | DTXSID801330670 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|
| Polarare Oberfläche (TPSA) | 47,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 315 |
|---|
| Löslichkeit | 38 [ug/mL] (The mean of the results at pH 7.4) |
|---|
