HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(-)-Bornan-2-on
Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, (1S)- · CAMPHORE · (-)-Alcanfor · Camphor Camphor · Levo-(-)-camphor · (1S)-(-)-Camphor 95% · (1S)-1,7,7-TRIMETHYLBICYCLO[2.2.1]HEPTAN-2-ONE · (1S,4S)-1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one
Identifikatoren & physikalische Daten
| CAS No. | 464-48-2 |
|---|---|
| Summenformel | C10H16O |
| Durchschnittliche Molmasse | 152,23 g/mol |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 |
| InChIKey | DSSYKIVIOFKYAU-XVKPBYJWSA-N |
| PubChem CID | 230921 |
| Lokaler Name | (-)-Bornan-2-on |
Chemische & physikalische Eigenschaften
| XLogP | 2,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 217 |
| Schmelzpunkt | 177-179 °C(lit.) |
| Siedepunkt | 204 °C(lit.) |
| Dichte | 0.990 |
| Dampfdichte | 5.24 (vs air) |
| Dampfdruck | 4 mm Hg ( 70 °C) |
| Brechungsindex | -44 ° (C=20, EtOH) |
| Flammpunkt | 148 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | DMF: 30 mg/mlDMSO: 20 mg/mlEthanol: 30 mg/mlEthanol:PBS (pH 7.2)(1:2): 0.33 mg/mlSoluble in water. (0.34 g/L) at 20°C |
| Aggregatzustand | Adhering Crystals or Crystalline Powder |
| Farbe | White to yellow |
| Wichte | 0.9853 (18℃) |
| Geruch | at 10.00 % in dipropylene glycol. camphor |
| Geruchsart | camphoreous |
| Explosionsgrenze | 0.6-4.5%(V) |
| Merck | 14,1732 |
| BRN | 4291747 |
| Stabilität | Stable. Incompatible with strong reducing agents, strong oxidizing agents, chlorinated solvents. Protect from direct sunlight. |
| InChI | 1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m0/s1 |
| InChIKey | DSSYKIVIOFKYAU-OIBJUYFYSA-N |
| SMILES | [H][C@]12CC[C@](C)(C(=O)C1)C2(C)C |
| LogP (Verteilungskoeffizient) | 2.089 (est) |
| CAS Datenbank | 464-48-2(CAS DataBase Reference) |
| EPA chemische Informationen | l-Camphor (464-48-2) |
Sicherheit & Vorschriften
| Regulatorische Informationen | (1R)-Camphor: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 2717 4.1/PG 3 |
| Zollcode | 29142910 |
| RTECS-Nr. | EX1250000 |
| R-Sätze (R) | 11-36/37/38 |
| Gefahrensymbole | F,Xi |
| Sicherheitshinweise (S) | 16-26 |
| Gefahrenklasse | 4.1Eye Irrit. 2Flam. Sol. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 4.1B - Flammable solid hazardous materials |
| Selbstentzündungstemperatur | 870 °F |
Anwendungen & Verwendung
Verwenden
(1S)-(-)-Camphor is used as chiral intermediate and chiral auxiliary precursor. It is used in the synthesis of high-potency sweeteners. It acts as catalytic agent and petrochemical additive.