HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzol-1,3-bis(acetyl)
Ethanone, 1,1'-(1,3-phenylene)bis- · 1,3-DiacetyL · M-DIACETYLBENZENE · 1,3-DIACETYLBENZENE · 1,3-Diacetytlbenzene · M-ACETYL ACETOPHENONE · 3'-Acetylacetophenone · 1,3-Diacetylbenzene>1,3-Diacetylbenzene,97%
Identifikatoren & physikalische Daten
| CAS No. | 6781-42-6 |
|---|---|
| Summenformel | C10H10O2 |
| Durchschnittliche Molmasse | 162,18 g/mol |
| Monoisotopische Masse | 162,06807956 g/mol |
| SMILES | CC(=O)c1cccc(C(C)=O)c1 |
| InChIKey | VCHOFVSNWYPAEF-UHFFFAOYSA-N |
| PubChem CID | 23229 |
| EC No. | 229-842-9 |
| DTXSID | DTXSID80218060 |
| Lokaler Name | Benzol-1,3-bis(acetyl) |
Chemische & physikalische Eigenschaften
| XLogP | 1,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 34,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 176 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP (Verteilungskoeffizient) | 1.43 |
| Schmelzpunkt | 28-32 °C (lit.) |
| Siedepunkt | 150-155 °C/15 mmHg (lit.) |
| Dichte | 1.0613 (rough estimate) |
| Brechungsindex | 1.5485-1.5505 |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-8°C |
| Löslichkeit | Soluble in ethanol, benzene, chloroform. |
| Aggregatzustand | Liquid After Melting |
| Farbe | Clear slightly yellow |
| BRN | 2042511 |
| InChI | InChI=1S/C10H10O2/c1-7(11)9-4-3-5-10(6-9)8(2)12/h3-6H,1-2H3 |
| InChIKey | VCHOFVSNWYPAEF-UHFFFAOYSA-N |
| SMILES | C1(C(=O)C)=CC=CC(C(=O)C)=C1 |
| CAS Datenbank | 6781-42-6(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29143990 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
1,3-Diacetylbenzene was used in the preparation of polyhydroxylated analogs. It is an important raw material and intermediates in organic synthesis.