Identifikatoren & physikalische Daten
| CAS No. | 108843-02-3 |
|---|
| Summenformel | C16H18O2 |
|---|
| Durchschnittliche Molmasse | 242,31 g/mol |
|---|
| Monoisotopische Masse | 242,13067981 g/mol |
|---|
| SMILES | CCC(O)C(O)(c1ccccc1)c1ccccc1 |
|---|
| InChIKey | DWBLJCMBQHQWRY-UHFFFAOYSA-N |
|---|
| PubChem CID | 233239 |
|---|
| EC No. | 683-018-7 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|
| Polarare Oberfläche (TPSA) | 40,5 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 2 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 221 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
