HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Coumaranone
BENZOFURAN-3(2H)-ONE · 3(2H)-BENZOFURANONE · COUMARANONE · Coumaran-3-one · 2,3-dihydro-1-benzofuran-3-one · 3-Oxocoumaran · 3-Coumaranone · BENZOFURAN-3-ONE
Identifikatoren & physikalische Daten
| CAS No. | 7169-34-8 |
|---|---|
| Summenformel | C8H6O2 |
| Durchschnittliche Molmasse | 134,13 g/mol |
| Monoisotopische Masse | 134,03677943 g/mol |
| SMILES | O=C1COc2ccccc21 |
| InChIKey | MGKPCLNUSDGXGT-UHFFFAOYSA-N |
| PubChem CID | 23556 |
| ChEMBL | CHEMBL2253270 |
| EC No. | 640-279-1 |
| DTXSID | DTXSID20221917 |
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 26,3 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 153 |
| Schmelzpunkt | 101-103 °C |
| Siedepunkt | 207.23°C (rough estimate) |
| Dichte | 1.1603 (rough estimate) |
| Brechungsindex | 1.4800 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| Löslichkeit | Chloroform (Slightly), DMSO (Slightly)Slightly miscible with water. |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 8.66 |
| Farbe | Yellow to Dark Yellow |
| BRN | 115296 |
| InChI | InChI=1S/C8H6O2/c9-7-5-10-8-4-2-1-3-6(7)8/h1-4H,5H2 |
| InChIKey | MGKPCLNUSDGXGT-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C(=O)C1 |
| CAS Datenbank | 7169-34-8(CAS DataBase Reference) |
| NIST chemische Informationen | 3(2H)-benzofuranone(7169-34-8) |
Sicherheit & Vorschriften
| F | 4.5-9 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29329990 |
| R-Sätze (R) | 36/37/38-20/21/22 |
| Gefahrensymbole | Xi,Xn |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 22-24/25-36/37/39-26-36 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
3-Coumaranone is used in the aurones, [2-benzylidenebenzofuran-3(2H)-ones] by reacting with appropriate aldehyde. It is involved in the condensation reaction with aldehydes in the presence of morpholine acetate to prepare substituted 2-(arylidene)benzofuran-3(ZH)-ones. In Horner-Wadsworth-Emmons reaction, it reacts with diethyl cyanomethylphosphonate to give 3-(cyanomethyl)benzofurans, which is an intermediate in the synthesis of antihyperglycemic agents.