HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2363723Erstellt: 27. Oktober 2026
2-Chloro-1-(4-cyclohexylphenyl)ethanone
Ethanone, 2-chloro-1-(4-cyclohexylphenyl)-
https://huagongshe.com/de/chemical/2363723
Identifikatoren & physikalische Daten
| CAS No. | 72825-30-0 |
|---|
| Summenformel | C14H17ClO |
|---|
| Durchschnittliche Molmasse | 236,73 g/mol |
|---|
| Monoisotopische Masse | 236,09679284 g/mol |
|---|
| SMILES | O=C(CCl)c1ccc(C2CCCCC2)cc1 |
|---|
| InChIKey | JQBRUWGVDKLWGP-UHFFFAOYSA-N |
|---|
| PubChem CID | 2363723 |
|---|
| EC No. | 127-308-9 |
|---|
| DTXSID | DTXSID70368265 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,9 |
|---|
| Polarare Oberfläche (TPSA) | 17,1 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 16 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 225 |
|---|
| Schmelzpunkt | 47-49 °C(Solv: ethanol (64-17-5)water (7732-18-5)) |
|---|
| Siedepunkt | 363.7±25.0 °C(Predicted) |
|---|
| Dichte | 1.108±0.06 g/cm3(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
