HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2392849Erstellt: 3. November 2026
3,5-Dichloro-2-[[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid
https://huagongshe.com/de/chemical/2392849
Identifikatoren & physikalische Daten
| CAS No. | 731793-15-0 |
|---|
| Summenformel | C21H14Cl2N4O4S |
|---|
| Durchschnittliche Molmasse | 489,3 g/mol |
|---|
| Monoisotopische Masse | 488,0112815 g/mol |
|---|
| SMILES | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)Nc1c(Cl)cc(Cl)cc1C(=O)O |
|---|
| InChIKey | WHGOFBGKKXICML-UHFFFAOYSA-N |
|---|
| PubChem CID | 2392849 |
|---|
| ChEMBL | CHEMBL1474719 |
|---|
| DTXSID | DTXSID701331168 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,9 |
|---|
| Polarare Oberfläche (TPSA) | 136 |
|---|
| H-Brücken-Donoren | 2 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 7 |
|---|
| Schwere Atome | 32 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 672 |
|---|
| Löslichkeit | 72.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 3,5-Dichloro-2-[[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid](/img/chemical/2392849.png)