HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2393628Erstellt: 27. Oktober 2026
N-{[5-(2-chloroacetyl)furan-2-yl]methyl}acetamide
Acetamide, N-[[5-(chloroacetyl)-2-furanyl]methyl]- · Acetamide, N-[[5-(2-chloroacetyl)-2-furanyl]methyl]-
https://huagongshe.com/de/chemical/2393628
Identifikatoren & physikalische Daten
| CAS No. | 115865-57-1 |
|---|
| Summenformel | C9H10ClNO3 |
|---|
| Durchschnittliche Molmasse | 215,63 g/mol |
|---|
| Monoisotopische Masse | 215,03492086 g/mol |
|---|
| SMILES | CC(=O)NCc1ccc(C(=O)CCl)o1 |
|---|
| InChIKey | CECVWYQULDGTQX-UHFFFAOYSA-N |
|---|
| PubChem CID | 2393628 |
|---|
| EC No. | 113-135-6 |
|---|
| DTXSID | DTXSID80368458 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 0,8 |
|---|
| Polarare Oberfläche (TPSA) | 59,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 232 |
|---|
| Siedepunkt | 464.3±45.0 °C(Predicted) |
|---|
| Dichte | 1.265±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 14.32±0.46(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
![Molekülstruktur von N-{[5-(2-chloroacetyl)furan-2-yl]methyl}acetamide](/img/chemical/2393628.png)