HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Bromo-4-fluoroaniline
2-BROMO-4-FLUORO-PHENYLAMINE · Bromofluoroaniline1 · 2-Bromo-4-fluoroanil · 4-FLUORO-2-BROMOANILINE · 2-BROMO-4-FLUOROANILINE · 2-Bromo-4-fluoroaniline99% · 2-Bromo-4-fluoroaniline >2-Bromo-4-fluoroaniline 99% · 2-BROMO-4-FLUOROANILINE 98+%
Identifikatoren & physikalische Daten
| CAS No. | 1003-98-1 |
|---|---|
| Summenformel | C6H5BrFN |
| Durchschnittliche Molmasse | 190,01 g/mol |
| Monoisotopische Masse | 188,95893948 g/mol |
| SMILES | Nc1ccc(F)cc1Br |
| InChIKey | YLMFXCIATJJKQL-UHFFFAOYSA-N |
| PubChem CID | 242873 |
| EC No. | 619-469-3 |
| DTXSID | DTXSID00287632 |
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 26 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 99,1 |
| Schmelzpunkt | 41 |
| Siedepunkt | 221 °C (lit.) |
| Dichte | 1.67 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.583(lit.) |
| Flammpunkt | 220 °F |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| pKa (Säurekonstante) | 2.60±0.10(Predicted) |
| Aggregatzustand | Liquid |
| Farbe | Clear yellow-brown |
| Wichte | 1.670 |
| BRN | 2802562 |
| InChI | InChI=1S/C6H5BrFN/c7-5-3-4(8)1-2-6(5)9/h1-3H,9H2 |
| InChIKey | YLMFXCIATJJKQL-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(F)C=C1Br |
| CAS Datenbank | 1003-98-1(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (18.8%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (18.8%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN2810 |
| Zollcode | 29214200 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi,T |
| hazard_note | Toxic |
| Sicherheitshinweise (S) | 26-37/39 |
| Gefahrenklasse | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Bromo-4-fluoroaniline is an organic compound that is an aniline derivative. It is mainly used as an organic synthesis reagent in experimental research.