4-Brom-2-nitrophenol
nsc402972 · 4-Bromo-nitrophenol · 4-Bromo-2-nitrophel · 4-BROMO-2-NITROPHENOL · 4-bromo-2-nitro-pheno · 2-NITRO-4-BROMOPHENOL · PHENOL, 2-NITRO-5-BROMO- · Phenol, 4-bromo-2-nitro-
Identifikatoren & physikalische Daten
| CAS No. | 7693-52-9 |
|---|---|
| Summenformel | C6H4BrNO3 |
| Durchschnittliche Molmasse | 218 g/mol |
| Monoisotopische Masse | 216,93745509 g/mol |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1O |
| InChIKey | CUTFAPGINUFNQM-UHFFFAOYSA-N |
| PubChem CID | 24364 |
| EC No. | 231-707-4 |
| DTXSID | DTXSID20227717 |
| Lokaler Name | 4-Brom-2-nitrophenol |
Chemische & physikalische Eigenschaften
| XLogP | 2,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 158 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Schmelzpunkt | 90-94 °C (lit.) |
| Siedepunkt | 259.4±20.0 °C(Predicted) |
| Dichte | 1.8994 (rough estimate) |
| Brechungsindex | 1.6090 (estimate) |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| pKa (Säurekonstante) | 6.28±0.14(Predicted) |
| Aggregatzustand | Crystalline Powder or Crystals |
| Farbe | Yellow |
| Löslichkeit | Slightly soluble |
| InChI | InChI=1S/C6H4BrNO3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H |
| InChIKey | CUTFAPGINUFNQM-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1[N+]([O-])=O |
| CAS Datenbank | 7693-52-9(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302+H332 (85.1%): Harmful if swallowed or if inhaled [Warning Acute toxicity, oralacute toxicity, inhalation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (89.4%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29089990 |
| RTECS-Nr. | SJ8370000 |
| R-Sätze (R) | 20/21/22-36/37/38-20/22 |
| Gefahrensymbole | Xn |
| hazard_note | Harmful |
| Sicherheitshinweise (S) | 26-36-36/37/39 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Beschreibung
4-bromo-2-nitrophenol is an essential intermediate for fine chemical engineering. It can be used to synthesize derivatives with biological activity, such as heterocyclic compounds as peptidase inhibitors for treating diabetes, introducing fluorine-containing groups as pesticides, and aminic compounds as Btk inhibitors for treating immune diseases.
Verwenden
4-Bromo-2-nitrophenol serves as a precursor for synthesizing ether derivatives. It reacts with 1,2-dibromoethane in the presence of NaOH to form 4-bromo-1-(2-bromoethoxy)-2-nitrobenzene, and couples with 1-(2-bromoethoxy)-2-nitrobenzene using K2CO3 in DMF to yield 4-bromo-2-nitro-1-[2-(2-nitrophenoxy)ethoxy]benzene[1-2].