Identifikatoren & physikalische Daten
| CAS No. | 386725-17-3 |
|---|
| Summenformel | C16H14N2O3 |
|---|
| Durchschnittliche Molmasse | 282,29 g/mol |
|---|
| Monoisotopische Masse | 282,10044231 g/mol |
|---|
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1ccncc1 |
|---|
| InChIKey | AFXVHJFQYIKSLK-UHFFFAOYSA-N |
|---|
| PubChem CID | 2452809 |
|---|
| ChEMBL | CHEMBL1449131 |
|---|
| DTXSID | DTXSID501331467 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,8 |
|---|
| Polarare Oberfläche (TPSA) | 59,5 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 393 |
|---|
| Löslichkeit | 33.1 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-(2,3-Dihydroindol-1-yl)-2-oxoethyl] pyridine-4-carboxylate](/img/chemical/2452809.png)