HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Budralazine
PTLZ · DJ-1461 · Butrazine · Buterazine · BUDRALAZINE · 1,2H-PHTHALAZONE · DIHYDROOXOPHTHALAZINE · Budralazine USP/EP/BP
Identifikatoren & physikalische Daten
| CAS No. | 36798-79-5 |
|---|---|
| Summenformel | C14H16N4 |
| Durchschnittliche Molmasse | 240,3 g/mol |
| Monoisotopische Masse | 240,13749653 g/mol |
| SMILES | CC(C)=CC(C)=NNc1nncc2ccccc12 |
| InChIKey | DQGFCLJXYFXXIJ-UHFFFAOYSA-N |
| PubChem CID | 2463 |
| ChEMBL | CHEMBL2107516 |
| DTXSID | DTXSID00865833 |
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 50,2 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 331 |
| Schmelzpunkt | 183-185 °C(lit.) |
| Siedepunkt | 373.02°C (rough estimate) |
| Dichte | 1.1506 (rough estimate) |
| Brechungsindex | 1.6000 (estimate) |
| Lagerbedingungen | Amber Vial, -20°C Freezer, Under inert atmosphere |
| Löslichkeit | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 9.54±0.70(Predicted) |
| Farbe | Light Yellow to Yellow |
| Stabilität | Light Sensitive |
| CAS Datenbank | 36798-79-5(CAS DataBase Reference) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| RTECS-Nr. | TH9185000 |
| R-Sätze (R) | 22 |
| Toxizität | LD50 in mice, rats (mg/kg): 1820, 620 orally4020, 3570 i.p. (Onodera) |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 22-24/25 |
Anwendungen & Verwendung
Beschreibung
Budralazine is an antihypertensive agent which is somewhat less potent than structurally related hydralazine, and reportedly produces less tachycardia.
Verwenden
Budralazine a new antihypertensive agent. Budralazine is a direct-acting vasodilator.