HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Buflomedil
BUFLOMEDIL · Buflomedilum · AURORA KA-850 · BufluomedilHcl · Buflomedil (base and/or unspecified salts) · 2',4',6'-Trimethoxy-4-(1-pyrrolidinyl)butyrophenone · 4-(1-pyrrolidinyl)-1-(2,4,6-trimethoxyphenyl)-1-butanon · 4-pyrrolidin-1-yl-1-(2,4,6-trimethoxyphenyl)butan-1-one
Identifikatoren & physikalische Daten
| CAS No. | 55837-25-7 |
|---|---|
| Summenformel | C17H25NO4 |
| Durchschnittliche Molmasse | 307,4 g/mol |
| Monoisotopische Masse | 307,17835828 g/mol |
| SMILES | COc1cc(OC)c(C(=O)CCCN2CCCC2)c(OC)c1 |
| InChIKey | OWYLAEYXIQKAOL-UHFFFAOYSA-N |
| PubChem CID | 2467 |
| ChEMBL | CHEMBL188921 |
| ChEBI | CHEBI:94538 |
| EC No. | 259-851-3 |
| DTXSID | DTXSID5022697 |
| Lokaler Name | Buflomedil |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 48 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 8 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 330 |
| Arzneimittel | Pharmaceuticals |
| Human Drugs | Pharmaceuticals |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 176.1 Ų [M+H]+ [CCS Type: DTBuffer gas: N2Ionization: ESI+Dataset: TOXCASTSource Identifier: DTXSID6046977]171.63 Ų [M+H-H2O]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| Siedepunkt | 454.5±45.0 °C(Predicted) |
| Dichte | 1.090±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 10.15±0.20(Predicted) |
| LogP (Verteilungskoeffizient) | 3.131 (est) |
| CAS Datenbank | 55837-25-7(CAS DataBase Reference) |
| NIST chemische Informationen | Buflomedil(55837-25-7) |
Sicherheit & Vorschriften
| Weitere Sicherheitsinformationen | IMAP assessments - 1-Butanone, 4-(1-pyrrolidinyl)-1-(2,4,6-trimethoxyphenyl)-: Human health tier I assessment |
|---|---|
| Drug Induced Liver Injury | Drug-Induced Liver Injury Severity and Toxicity (DILIst)BuflomedilDILI PositiveDOI:10.1016/j.drudis.2019.09.022 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29339990 |
| RTECS-Nr. | EL9885000 |
| R-Sätze (R) | 20/21/22-36/37/38 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-36 |
Anwendungen & Verwendung
Verwenden
BAN; DCF; MI.