HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2467460Erstellt: 3. November 2026
(2-Chloro-6-fluorophenyl)methyl 2-[(5-methylthiophene-2-carbonyl)amino]acetate
https://huagongshe.com/de/chemical/2467460
Identifikatoren & physikalische Daten
| CAS No. | 571158-39-9 |
|---|
| Summenformel | C15H13ClFNO3S |
|---|
| Durchschnittliche Molmasse | 341,8 g/mol |
|---|
| Monoisotopische Masse | 341,0288703 g/mol |
|---|
| SMILES | Cc1ccc(C(=O)NCC(=O)OCc2c(F)cccc2Cl)s1 |
|---|
| InChIKey | LGWGUYFXGRUFTD-UHFFFAOYSA-N |
|---|
| PubChem CID | 2467460 |
|---|
| ChEMBL | CHEMBL1891300 |
|---|
| DTXSID | DTXSID201322534 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|
| Polarare Oberfläche (TPSA) | 83,6 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 6 |
|---|
| Schwere Atome | 22 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 412 |
|---|
| Löslichkeit | 9.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von (2-Chloro-6-fluorophenyl)methyl 2-[(5-methylthiophene-2-carbonyl)amino]acetate](/img/chemical/2467460.png)