HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 246773Erstellt: 1. November 2026
2-Butoxy-5-nitropyridine
Pyridine, 2-butoxy-5-nitro- · Pyridine, 2-butoxy-5-nitro- (7CI,9CI)
https://huagongshe.com/de/chemical/246773
Identifikatoren & physikalische Daten
| CAS No. | 6627-95-8 |
|---|
| Summenformel | C9H12N2O3 |
|---|
| Durchschnittliche Molmasse | 196,2 g/mol |
|---|
| Monoisotopische Masse | 196,08479225 g/mol |
|---|
| SMILES | CCCCOc1ccc([N+](=O)[O-])cn1 |
|---|
| InChIKey | GEMGCBQSLUFODV-UHFFFAOYSA-N |
|---|
| PubChem CID | 246773 |
|---|
| EC No. | 654-315-9 |
|---|
| DTXSID | DTXSID60289314 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,8 |
|---|
| Polarare Oberfläche (TPSA) | 67,9 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 14 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 181 |
|---|
| Schmelzpunkt | 148-150 °C |
|---|
| Siedepunkt | 301.4±22.0 °C(Predicted) |
|---|
| Dichte | 1.167±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 0.04±0.22(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Achtung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
