HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 248608Erstellt: 4. November 2026
9-Bromo-2,4,7-trichlorofluorene
9-Bromo-2,4,7-trichlorofluorene · 9H-Fluorene, 9-bromo-2,4,7-trichloro-
https://huagongshe.com/de/chemical/248608
Identifikatoren & physikalische Daten
| CAS No. | 7012-19-3 |
|---|
| Summenformel | C13H6BrCl3 |
|---|
| Durchschnittliche Molmasse | 348,4 g/mol |
|---|
| Monoisotopische Masse | 345,87185 g/mol |
|---|
| SMILES | Clc1ccc2c(c1)C(Br)c1cc(Cl)cc(Cl)c1-2 |
|---|
| InChIKey | QOVQXCVVFBVTQL-UHFFFAOYSA-N |
|---|
| PubChem CID | 248608 |
|---|
| EC No. | 668-212-1 |
|---|
| DTXSID | DTXSID60289970 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 5,8 |
|---|
| Polarare Oberfläche (TPSA) | 0 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 0 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 17 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 298 |
|---|
| Schmelzpunkt | 181 °C(Solv: benzene (71-43-2)ligroine (8032-32-4)) |
|---|
| Siedepunkt | 405.2±45.0 °C(Predicted) |
|---|
| Dichte | 1.755±0.06 g/cm3(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
