Identifikatoren & physikalische Daten
| CAS No. | 796103-57-6 |
|---|
| Summenformel | C14H14Cl2N2O |
|---|
| Durchschnittliche Molmasse | 297,2 g/mol |
|---|
| Monoisotopische Masse | 296,0483185 g/mol |
|---|
| SMILES | Cc1ccc(CNC(=O)c2cc(Cl)cc(Cl)c2)n1C |
|---|
| InChIKey | HOEXVBPHVLLGQO-UHFFFAOYSA-N |
|---|
| PubChem CID | 2489618 |
|---|
| ChEMBL | CHEMBL1376077 |
|---|
| DTXSID | DTXSID601324982 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,1 |
|---|
| Polarare Oberfläche (TPSA) | 34 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 317 |
|---|
| Löslichkeit | 11.1 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von 3,5-dichloro-N-[(1,5-dimethylpyrrol-2-yl)methyl]benzamide](/img/chemical/2489618.png)