HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2535430Erstellt: 3. November 2026
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 2-methylsulfanylpyridine-3-carboxylate
https://huagongshe.com/de/chemical/2535430
Identifikatoren & physikalische Daten
| CAS No. | 807388-77-8 |
|---|
| Summenformel | C13H12N2O3S |
|---|
| Durchschnittliche Molmasse | 276,31 g/mol |
|---|
| Monoisotopische Masse | 276,05686342 g/mol |
|---|
| SMILES | CSc1ncccc1C(=O)OCC(=O)c1ccc[nH]1 |
|---|
| InChIKey | KAEMDDLYZHCBHH-UHFFFAOYSA-N |
|---|
| PubChem CID | 2535430 |
|---|
| ChEMBL | CHEMBL1903318 |
|---|
| DTXSID | DTXSID701328963 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|
| Polarare Oberfläche (TPSA) | 97,4 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 6 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 338 |
|---|
| Löslichkeit | 9.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 2-methylsulfanylpyridine-3-carboxylate](/img/chemical/2535430.png)