HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
N-((4-hydroxy-3-methoxyphenyl)methyl)-8-methylnon-6-enamide
Capsaicin (E/Z-Mixture) · (E/Z)-8-Methyl-N-vanillyl-6-nonenaMide · N-(4-hydroxy-3-methoxybenzyl)-8-methylnon-6-enamide · 6-Nonenamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyl- · Capsaicin-D3 (E/Z-Mixture)Q: What is Capsaicin-D3 (E/Z-Mixture) Q: What is the CAS Number of Capsaicin-D3 (E/Z-Mixture) Q: What is the storage condition of Capsaicin-D3 (E/Z-Mixture) Q: What are the applications of Capsaicin-D3 (E/Z-Mixture)
Identifikatoren & physikalische Daten
| CAS No. | 7553-53-9 |
|---|---|
| Summenformel | C18H27NO3 |
| Durchschnittliche Molmasse | 305,4 g/mol |
| Monoisotopische Masse | 305,19909372 g/mol |
| SMILES | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1O |
| InChIKey | YKPUWZUDDOIDPM-UHFFFAOYSA-N |
| PubChem CID | 2548 |
| ChEMBL | CHEMBL3187928 |
| DTXSID | DTXSID40859357 |
Chemische & physikalische Eigenschaften
| XLogP | 3,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 58,6 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 9 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 341 |
| Schmelzpunkt | 60-620C |
| Siedepunkt | 511.5±50.0 °C(Predicted) |
| Dichte | 1.041±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -20°C Freezer, Under Inert Atmosphere |
| pKa (Säurekonstante) | 9.76±0.20(Predicted) |
Anwendungen & Verwendung
Verwenden
Capsaicin(E/Z-Mixture) is a representative lot is a 5:1 E:Z mixture. Has been isolated from paprika and cayenne. It is used as a tool in neurobiological research. Prototype vanilloid receptor agonist. Topical analgesic.