HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2571237Erstellt: 31. Oktober 2026
[2-[1-(2-Methoxyethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate
https://huagongshe.com/de/chemical/2571237
Identifikatoren & physikalische Daten
| CAS No. | 852545-48-3 |
|---|
| Summenformel | C18H22N2O4S |
|---|
| Durchschnittliche Molmasse | 362,4 g/mol |
|---|
| Monoisotopische Masse | 362,13002836 g/mol |
|---|
| SMILES | COCCn1c(C)cc(C(=O)COC(=O)c2cccnc2SC)c1C |
|---|
| InChIKey | JGGLJBZLPIRDPG-UHFFFAOYSA-N |
|---|
| PubChem CID | 2571237 |
|---|
| ChEMBL | CHEMBL1715634 |
|---|
| DTXSID | DTXSID601326407 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|
| Polarare Oberfläche (TPSA) | 95,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 9 |
|---|
| Schwere Atome | 25 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 462 |
|---|
| Löslichkeit | 5.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-[1-(2-Methoxyethyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate](/img/chemical/2571237.png)