HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-(Hydroxymethyl)-6-(1H-Indol-3-Yloxy)Oxane-3,4,5-Triol
Indoxyl sulfate · INDICAN · 3-Indoxyl-β-D-glucopyranoside · C08481 · V10029 · V 10029 · V-10029 · Uroxanthin
Identifikatoren & physikalische Daten
| CAS No. | 487-60-5 |
|---|---|
| Summenformel | C14H17NO6 |
| Durchschnittliche Molmasse | 295,29 g/mol |
| Monoisotopische Masse | 295,10558726 g/mol |
| SMILES | OCC1OC(Oc2c[nH]c3ccccc23)C(O)C(O)C1O |
| InChIKey | XVARCVCWNFACQC-UHFFFAOYSA-N |
| PubChem CID | 258533 |
| ChEMBL | CHEMBL1561942 |
| ChEBI | CHEBI:143543 |
| DTXSID | DTXSID10862015 |
Chemische & physikalische Eigenschaften
| XLogP | -0,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 115 |
| H-Brücken-Donoren | 5 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 356 |
| Löslichkeit | >44.3 [ug/mL] (The mean of the results at pH 7.4)H2O: 0.1 M at 20 °C, clear to slightly hazy, colorless to faint yellow-greenH2O: 0.1M, clear to slightly hazy |
| Schmelzpunkt | 57-58 °C |
| Siedepunkt | 606.7±55.0 °C(Predicted) |
| Dichte | 1.562±0.06 g/cm3(Predicted) |
| Lagerbedingungen | -20°C |
| pKa (Säurekonstante) | 12.92±0.70(Predicted) |
| Aggregatzustand | Solid |
| Farbe | White to Pale Grey |
| Merck | 14,4942 |
| Stabilität | Hygroscopic |
| InChI | InChI=1/C14H17NO6/c16-6-10-11(17)12(18)13(19)14(21-10)20-9-5-15-8-4-2-1-3-7(8)9/h1-5,10-19H,6H2/t10-,11-,12+,13-,14-/s3 |
| InChIKey | XVARCVCWNFACQC-JOAVLQHANA-N |
| SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)C1=CNC2C=CC=CC1=2 |&1:1,2,3,5,7,r| |
| CAS Datenbank | 487-60-5 |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| Zollcode | 29389090 |
| Sicherheitshinweise (S) | 22-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
colorimetric substrate for laminarinase