HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
8-(benzylsulfanylmethyl)-1,3-dimethyl-7H-purine-2,6-dione
TPBM · 8-[(Benzylthio)methyl]theophylline · Theophylline, 8-[(benzylthio)methyl] · 8-Benzylsulfanylmethyl-1,3-dimethyl-3,7-dihydro-purine-2,6-dione · 1H-Purine-2,6-dione, 3,9-dihydro-1,3-dimethyl-8-[[(phenylmethyl)thio]methyl]-
Identifikatoren & physikalische Daten
| CAS No. | 6466-43-9 |
|---|---|
| Summenformel | C15H16N4O2S |
| Durchschnittliche Molmasse | 316,4 g/mol |
| Monoisotopische Masse | 316,09939694 g/mol |
| SMILES | Cn1c(=O)c2[nH]c(CSCc3ccccc3)nc2n(C)c1=O |
| InChIKey | FEHAMBYTUPDFJE-UHFFFAOYSA-N |
| PubChem CID | 262425 |
| ChEMBL | CHEMBL1329166 |
| DTXSID | DTXSID40294345 |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 94,6 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 441 |
| Schmelzpunkt | 210-212 °C |
| Siedepunkt | 569.6±60.0 °C(Predicted) |
| Dichte | 1.373±0.06 g/cm3(Predicted) |
| Löslichkeit | DMSO: >5mg/mL |
| Aggregatzustand | solid |
| pKa (Säurekonstante) | 8.20±0.70(Predicted) |
| Farbe | white to off-white |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|
Anwendungen & Verwendung
Verwenden
TPBM is a potent inhibitor of estrogen receptor α.