Identifikatoren & physikalische Daten
| CAS No. | 128500-58-3 |
|---|
| Summenformel | C16H14N2O5 |
|---|
| Durchschnittliche Molmasse | 314,29 g/mol |
|---|
| Monoisotopische Masse | 314,09027155 g/mol |
|---|
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC(=O)c1ccccc1 |
|---|
| InChIKey | ZEAVQYGCBBNOHZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 263200 |
|---|
| EC No. | 654-345-2 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|
| Polarare Oberfläche (TPSA) | 101 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 5 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 442 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P273, P280, P305+P351+P338, P337+P317, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
