Identifikatoren & physikalische Daten
| CAS No. | 17490-47-0 |
|---|
| Summenformel | C18H17BrNP |
|---|
| Durchschnittliche Molmasse | 358,2 g/mol |
|---|
| Monoisotopische Masse | 357,0282 g/mol |
|---|
| SMILES | NP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
| InChIKey | ULPYCPLTHVWYER-UHFFFAOYSA-N |
|---|
| PubChem CID | 264136 |
|---|
| EC No. | 112-735-5 |
|---|
| DTXSID | DTXSID70294974 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4,8 |
|---|
| Polarare Oberfläche (TPSA) | 26 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 21 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 293 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P272, P280, P301+P317, P302+P352, P305+P354+P338, P317, P319, P321, P330, P333+P317, P362+P364, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
