HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 2642003Erstellt: 2. November 2026
[2-(3,5-Dimethoxyanilino)-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate
https://huagongshe.com/de/chemical/2642003
Identifikatoren & physikalische Daten
| CAS No. | 380569-65-3 |
|---|
| Summenformel | C21H23FN2O8S |
|---|
| Durchschnittliche Molmasse | 482,5 g/mol |
|---|
| Monoisotopische Masse | 482,11591503 g/mol |
|---|
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)cc(OC)c1 |
|---|
| InChIKey | FURRQUXLADTLOM-UHFFFAOYSA-N |
|---|
| PubChem CID | 2642003 |
|---|
| ChEMBL | CHEMBL2134340 |
|---|
| DTXSID | DTXSID001332703 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|
| Polarare Oberfläche (TPSA) | 129 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 10 |
|---|
| Frei drehbare Bindungen | 9 |
|---|
| Schwere Atome | 33 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 759 |
|---|
| Löslichkeit | 34.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![Molekülstruktur von [2-(3,5-Dimethoxyanilino)-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate](/img/chemical/2642003.png)